C14H22N4O — CID 62991029
1-(4-aminophenyl)-3-(3-pyrrolidin-1-ylpropyl)urea (PubChem CID 62991029) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-(3-pyrrolidin-1-ylpropyl)urea.
| Compound Name | 1-(4-aminophenyl)-3-(3-pyrrolidin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 62991029 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1-(4-aminophenyl)-3-(3-pyrrolidin-1-ylpropyl)urea |
| SMILES | Nc1ccc(NC(=O)NCCCN2CCCC2)cc1 |
| InChI | InChI=1S/C14H22N4O/c15-12-4-6-13(7-5-12)17-14(19)16-8-3-11-18-9-1-2-10-18/h4-7H,1-3,8-11,15H2,(H2,16,17,19) |
| InChIKey | UJUNJGRFDFHOAY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|