C20H27N3OS — CID 59152408
1-(4-piperidin-1-ylbutyl)-3-(4-thiophen-2-ylphenyl)urea (PubChem CID 59152408) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is 1-(4-piperidin-1-ylbutyl)-3-(4-thiophen-2-ylphenyl)urea.
| Compound Name | 1-(4-piperidin-1-ylbutyl)-3-(4-thiophen-2-ylphenyl)urea |
|---|---|
| PubChem CID | 59152408 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1-(4-piperidin-1-ylbutyl)-3-(4-thiophen-2-ylphenyl)urea |
| SMILES | O=C(NCCCCN1CCCCC1)Nc1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C20H27N3OS/c24-20(21-12-2-5-15-23-13-3-1-4-14-23)22-18-10-8-17(9-11-18)19-7-6-16-25-19/h6-11,16H,1-5,12-15H2,(H2,21,22,24) |
| InChIKey | NEDIJQJACZGHFL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|