C20H26N2OS — CID 59840354
5-piperidin-1-yl-N-(4-thiophen-2-ylphenyl)pentanamide (PubChem CID 59840354) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 5-piperidin-1-yl-N-(4-thiophen-2-ylphenyl)pentanamide.
| Compound Name | 5-piperidin-1-yl-N-(4-thiophen-2-ylphenyl)pentanamide |
|---|---|
| PubChem CID | 59840354 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 5-piperidin-1-yl-N-(4-thiophen-2-ylphenyl)pentanamide |
| SMILES | O=C(CCCCN1CCCCC1)Nc1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C20H26N2OS/c23-20(8-2-5-15-22-13-3-1-4-14-22)21-18-11-9-17(10-12-18)19-7-6-16-24-19/h6-7,9-12,16H,1-5,8,13-15H2,(H,21,23) |
| InChIKey | NIFMPVNYGVDULS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|