C21H29N3O — CID 144597472
N-[4-(1,2-dihydropyridin-5-yl)phenyl]-5-piperidin-1-ylpentanamide (PubChem CID 144597472) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[4-(1,2-dihydropyridin-5-yl)phenyl]-5-piperidin-1-ylpentanamide.
| Compound Name | N-[4-(1,2-dihydropyridin-5-yl)phenyl]-5-piperidin-1-ylpentanamide |
|---|---|
| PubChem CID | 144597472 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | N-[4-(1,2-dihydropyridin-5-yl)phenyl]-5-piperidin-1-ylpentanamide |
| SMILES | O=C(CCCCN1CCCCC1)Nc1ccc(C2=CNCC=C2)cc1 |
| InChI | InChI=1S/C21H29N3O/c25-21(8-2-5-16-24-14-3-1-4-15-24)23-20-11-9-18(10-12-20)19-7-6-13-22-17-19/h6-7,9-12,17,22H,1-5,8,13-16H2,(H,23,25) |
| InChIKey | NAWBUGYONMPBAV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|