C24H37N3O — CID 59036107
N-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]-5-piperidin-1-ylpentanamide (PubChem CID 59036107) has the molecular formula C24H37N3O and a molecular weight of 383.58 g/mol. Its IUPAC name is N-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]-5-piperidin-1-ylpentanamide.
| Compound Name | N-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]-5-piperidin-1-ylpentanamide |
|---|---|
| PubChem CID | 59036107 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | N-[4-[(3R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl]phenyl]-5-piperidin-1-ylpentanamide |
| SMILES | O=C(CCCCN1CCCCC1)Nc1ccc([C@H]2CC[C@H]3CCCCN32)cc1 |
| InChI | InChI=1S/C24H37N3O/c28-24(9-3-6-18-26-16-4-1-5-17-26)25-21-12-10-20(11-13-21)23-15-14-22-8-2-7-19-27(22)23/h10-13,22-23H,1-9,14-19H2,(H,25,28)/t22-,23-/m1/s1 |
| InChIKey | DSQAJPDGIOIAPI-DHIUTWEWSA-N |
| XLogP | 4.97 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|