C16H25ClN4S — CID 17382313
1-(4-chlorophenyl)-3-[3-(4-ethylpiperazin-1-yl)propyl]thiourea (PubChem CID 17382313) has the molecular formula C16H25ClN4S and a molecular weight of 340.92 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-(4-ethylpiperazin-1-yl)propyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-(4-ethylpiperazin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 17382313 |
| Molecular Formula | C16H25ClN4S |
| Molecular Weight | 340.92 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-(4-ethylpiperazin-1-yl)propyl]thiourea |
| SMILES | CCN1CCN(CCCNC(=S)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H25ClN4S/c1-2-20-10-12-21(13-11-20)9-3-8-18-16(22)19-15-6-4-14(17)5-7-15/h4-7H,2-3,8-13H2,1H3,(H2,18,19,22) |
| InChIKey | FMQYNHUXNJAQEJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.92 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|