C20H32N4O2S — CID 5079820
ethyl 4-[3-(4-propylpiperazin-1-yl)propylcarbamothioylamino]benzoate (PubChem CID 5079820) has the molecular formula C20H32N4O2S and a molecular weight of 392.57 g/mol. Its IUPAC name is ethyl 4-[3-(4-propylpiperazin-1-yl)propylcarbamothioylamino]benzoate.
| Compound Name | ethyl 4-[3-(4-propylpiperazin-1-yl)propylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 5079820 |
| Molecular Formula | C20H32N4O2S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | ethyl 4-[3-(4-propylpiperazin-1-yl)propylcarbamothioylamino]benzoate |
| SMILES | CCCN1CCN(CCCNC(=S)Nc2ccc(C(=O)OCC)cc2)CC1 |
| InChI | InChI=1S/C20H32N4O2S/c1-3-11-23-13-15-24(16-14-23)12-5-10-21-20(27)22-18-8-6-17(7-9-18)19(25)26-4-2/h6-9H,3-5,10-16H2,1-2H3,(H2,21,22,27) |
| InChIKey | SXAIXVSSVLTAOT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|