C16H24BrN3S — CID 100631402
1-(4-bromophenyl)-3-[3-(4-methylpiperidin-1-yl)propyl]thiourea (PubChem CID 100631402) has the molecular formula C16H24BrN3S and a molecular weight of 370.36 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[3-(4-methylpiperidin-1-yl)propyl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[3-(4-methylpiperidin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 100631402 |
| Molecular Formula | C16H24BrN3S |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 1-(4-bromophenyl)-3-[3-(4-methylpiperidin-1-yl)propyl]thiourea |
| SMILES | CC1CCN(CCCNC(=S)Nc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C16H24BrN3S/c1-13-7-11-20(12-8-13)10-2-9-18-16(21)19-15-5-3-14(17)4-6-15/h3-6,13H,2,7-12H2,1H3,(H2,18,19,21) |
| InChIKey | LLSDRIZRWDJCQL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|