C23H30BrN3O3 — CID 55847749
5-bromo-N-[4-[2-[4-(4-methylpiperidin-1-yl)butylamino]-2-oxoethyl]phenyl]furan-2-carboxamide (PubChem CID 55847749) has the molecular formula C23H30BrN3O3 and a molecular weight of 476.42 g/mol. Its IUPAC name is 5-bromo-N-[4-[2-[4-(4-methylpiperidin-1-yl)butylamino]-2-oxoethyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[2-[4-(4-methylpiperidin-1-yl)butylamino]-2-oxoethyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55847749 |
| Molecular Formula | C23H30BrN3O3 |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 5-bromo-N-[4-[2-[4-(4-methylpiperidin-1-yl)butylamino]-2-oxoethyl]phenyl]furan-2-carboxamide |
| SMILES | CC1CCN(CCCCNC(=O)Cc2ccc(NC(=O)c3ccc(Br)o3)cc2)CC1 |
| InChI | InChI=1S/C23H30BrN3O3/c1-17-10-14-27(15-11-17)13-3-2-12-25-22(28)16-18-4-6-19(7-5-18)26-23(29)20-8-9-21(24)30-20/h4-9,17H,2-3,10-16H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | MFRIMZFXLCPMIP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|