C11H21BrN2O — CID 63679463
2-bromo-N-[3-(4-methylpiperidin-1-yl)propyl]acetamide (PubChem CID 63679463) has the molecular formula C11H21BrN2O and a molecular weight of 277.21 g/mol. Its IUPAC name is 2-bromo-N-[3-(4-methylpiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-bromo-N-[3-(4-methylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 63679463 |
| Molecular Formula | C11H21BrN2O |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-bromo-N-[3-(4-methylpiperidin-1-yl)propyl]acetamide |
| SMILES | CC1CCN(CCCNC(=O)CBr)CC1 |
| InChI | InChI=1S/C11H21BrN2O/c1-10-3-7-14(8-4-10)6-2-5-13-11(15)9-12/h10H,2-9H2,1H3,(H,13,15) |
| InChIKey | IMIHSJDMXACFFY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|