C25H47N3O2 — CID 165007896
3-(4-methylpiperidin-1-yl)-N-[10-(4-methylpiperidin-1-yl)-8-oxodecyl]propanamide (PubChem CID 165007896) has the molecular formula C25H47N3O2 and a molecular weight of 421.67 g/mol. Its IUPAC name is 3-(4-methylpiperidin-1-yl)-N-[10-(4-methylpiperidin-1-yl)-8-oxodecyl]propanamide.
| Compound Name | 3-(4-methylpiperidin-1-yl)-N-[10-(4-methylpiperidin-1-yl)-8-oxodecyl]propanamide |
|---|---|
| PubChem CID | 165007896 |
| Molecular Formula | C25H47N3O2 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.37 |
| IUPAC Name | 3-(4-methylpiperidin-1-yl)-N-[10-(4-methylpiperidin-1-yl)-8-oxodecyl]propanamide |
| SMILES | CC1CCN(CCC(=O)CCCCCCCNC(=O)CCN2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C25H47N3O2/c1-22-9-16-27(17-10-22)20-13-24(29)8-6-4-3-5-7-15-26-25(30)14-21-28-18-11-23(2)12-19-28/h22-23H,3-21H2,1-2H3,(H,26,30) |
| InChIKey | JGCCZJGLZFHCCM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|