C17H26FN3S — CID 100736580
1-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-(4-fluorophenyl)thiourea (PubChem CID 100736580) has the molecular formula C17H26FN3S and a molecular weight of 323.48 g/mol. Its IUPAC name is 1-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 100736580 |
| Molecular Formula | C17H26FN3S |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-(4-fluorophenyl)thiourea |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCNC(=S)Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H26FN3S/c1-13-10-14(2)12-21(11-13)9-3-8-19-17(22)20-16-6-4-15(18)5-7-16/h4-7,13-14H,3,8-12H2,1-2H3,(H2,19,20,22)/t13-,14-/m1/s1 |
| InChIKey | PUGLPAVARNALLA-ZIAGYGMSSA-N |
| XLogP | 3.48 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|