C22H35N3OS — CID 100737565
1-(4-cyclopentyloxyphenyl)-3-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]thiourea (PubChem CID 100737565) has the molecular formula C22H35N3OS and a molecular weight of 389.61 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-3-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]thiourea.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-3-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 100737565 |
| Molecular Formula | C22H35N3OS |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-3-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]thiourea |
| SMILES | C[C@@H]1C[C@H](C)CN(CCCNC(=S)Nc2ccc(OC3CCCC3)cc2)C1 |
| InChI | InChI=1S/C22H35N3OS/c1-17-14-18(2)16-25(15-17)13-5-12-23-22(27)24-19-8-10-21(11-9-19)26-20-6-3-4-7-20/h8-11,17-18,20H,3-7,12-16H2,1-2H3,(H2,23,24,27)/t17-,18+ |
| InChIKey | LGPKSFCGFDXLKT-HDICACEKSA-N |
| XLogP | 4.66 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|