C11H15N3O4S2 — CID 10495711
4-[(4-sulfamoylphenyl)carbamothioylamino]butanoic acid (PubChem CID 10495711) has the molecular formula C11H15N3O4S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-[(4-sulfamoylphenyl)carbamothioylamino]butanoic acid.
| Compound Name | 4-[(4-sulfamoylphenyl)carbamothioylamino]butanoic acid |
|---|---|
| PubChem CID | 10495711 |
| Molecular Formula | C11H15N3O4S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4-[(4-sulfamoylphenyl)carbamothioylamino]butanoic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NCCCC(=O)O)cc1 |
| InChI | InChI=1S/C11H15N3O4S2/c12-20(17,18)9-5-3-8(4-6-9)14-11(19)13-7-1-2-10(15)16/h3-6H,1-2,7H2,(H,15,16)(H2,12,17,18)(H2,13,14,19) |
| InChIKey | JZWYSVWTQHKGPQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|