C17H20N4O4S — CID 108989678
N-[4-[2-(4-sulfamoylphenyl)ethylcarbamoylamino]phenyl]acetamide (PubChem CID 108989678) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[4-[2-(4-sulfamoylphenyl)ethylcarbamoylamino]phenyl]acetamide.
| Compound Name | N-[4-[2-(4-sulfamoylphenyl)ethylcarbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 108989678 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[4-[2-(4-sulfamoylphenyl)ethylcarbamoylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)NCCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H20N4O4S/c1-12(22)20-14-4-6-15(7-5-14)21-17(23)19-11-10-13-2-8-16(9-3-13)26(18,24)25/h2-9H,10-11H2,1H3,(H,20,22)(H2,18,24,25)(H2,19,21,23) |
| InChIKey | NQBWUVOTSSOEJE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |