C21H28N4O3 — CID 44604568
triethyl-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]azanium formate (PubChem CID 44604568) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is triethyl-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]azanium formate.
| Compound Name | triethyl-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]azanium formate |
|---|---|
| PubChem CID | 44604568 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | triethyl-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]azanium formate |
| SMILES | CC[N+](CC)(CC)CC(=O)Nc1ccc(/N=N/c2ccccc2)cc1.O=C[O-] |
| InChI | InChI=1S/C20H26N4O.CH2O2/c1-4-24(5-2,6-3)16-20(25)21-17-12-14-19(15-13-17)23-22-18-10-8-7-9-11-18;2-1-3/h7-15H,4-6,16H2,1-3H3;1H,(H,2,3) |
| InChIKey | WRCVUTUQKLIGFJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|