C22H32N2O3SSi — CID 91997824
3-triethoxysilylpropyl N,N'-diphenylcarbamimidothioate (PubChem CID 91997824) has the molecular formula C22H32N2O3SSi and a molecular weight of 432.66 g/mol. Its IUPAC name is 3-triethoxysilylpropyl N,N'-diphenylcarbamimidothioate.
| Compound Name | 3-triethoxysilylpropyl N,N'-diphenylcarbamimidothioate |
|---|---|
| PubChem CID | 91997824 |
| Molecular Formula | C22H32N2O3SSi |
| Molecular Weight | 432.66 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 3-triethoxysilylpropyl N,N'-diphenylcarbamimidothioate |
| SMILES | CCO[Si](CCCS/C(=N\c1ccccc1)Nc1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C22H32N2O3SSi/c1-4-25-29(26-5-2,27-6-3)19-13-18-28-22(23-20-14-9-7-10-15-20)24-21-16-11-8-12-17-21/h7-12,14-17H,4-6,13,18-19H2,1-3H3,(H,23,24) |
| InChIKey | VFLSUUHXXYWBPG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|