C22H42N2O7Si2 — CID 159457965
triethoxy(3-isocyanatopropyl)silane;N-(3-trimethoxysilylpropyl)aniline (PubChem CID 159457965) has the molecular formula C22H42N2O7Si2 and a molecular weight of 502.76 g/mol. Its IUPAC name is triethoxy(3-isocyanatopropyl)silane;N-(3-trimethoxysilylpropyl)aniline.
| Compound Name | triethoxy(3-isocyanatopropyl)silane;N-(3-trimethoxysilylpropyl)aniline |
|---|---|
| PubChem CID | 159457965 |
| Molecular Formula | C22H42N2O7Si2 |
| Molecular Weight | 502.76 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | triethoxy(3-isocyanatopropyl)silane;N-(3-trimethoxysilylpropyl)aniline |
| SMILES | CCO[Si](CCCN=C=O)(OCC)OCC.CO[Si](CCCNc1ccccc1)(OC)OC |
| InChI | InChI=1S/C12H21NO3Si.C10H21NO4Si/c1-14-17(15-2,16-3)11-7-10-13-12-8-5-4-6-9-12;1-4-13-16(14-5-2,15-6-3)9-7-8-11-10-12/h4-6,8-9,13H,7,10-11H2,1-3H3;4-9H2,1-3H3 |
| InChIKey | LUFLSJNCLSPJKJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.76 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|