C12H23N2O3Si2 — CID 165388786
CID 165388786 (PubChem CID 165388786) has the molecular formula C12H23N2O3Si2 and a molecular weight of 299.50 g/mol.
| Compound Name | CID 165388786 |
|---|---|
| PubChem CID | 165388786 |
| Molecular Formula | C12H23N2O3Si2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | — |
| SMILES | CO[Si](CCCNc1ccccc1)(OC)OC.N[Si] |
| InChI | InChI=1S/C12H21NO3Si.H2NSi/c1-14-17(15-2,16-3)11-7-10-13-12-8-5-4-6-9-12;1-2/h4-6,8-9,13H,7,10-11H2,1-3H3;1H2 |
| InChIKey | QXPJRAYRRYZYAR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|