C18H36N2O6Si2 — CID 19877439
1-N,2-N-bis(3-trimethoxysilylpropyl)benzene-1,2-diamine (PubChem CID 19877439) has the molecular formula C18H36N2O6Si2 and a molecular weight of 432.67 g/mol. Its IUPAC name is 1-N,2-N-bis(3-trimethoxysilylpropyl)benzene-1,2-diamine.
| Compound Name | 1-N,2-N-bis(3-trimethoxysilylpropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 19877439 |
| Molecular Formula | C18H36N2O6Si2 |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-N,2-N-bis(3-trimethoxysilylpropyl)benzene-1,2-diamine |
| SMILES | CO[Si](CCCNc1ccccc1NCCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C18H36N2O6Si2/c1-21-27(22-2,23-3)15-9-13-19-17-11-7-8-12-18(17)20-14-10-16-28(24-4,25-5)26-6/h7-8,11-12,19-20H,9-10,13-16H2,1-6H3 |
| InChIKey | VAIDZAMRYKQFKQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|