C20H25NO5Si — CID 67533346
1-phenyl-2-[2-(3-trimethoxysilylpropylamino)phenyl]ethane-1,2-dione (PubChem CID 67533346) has the molecular formula C20H25NO5Si and a molecular weight of 387.51 g/mol. Its IUPAC name is 1-phenyl-2-[2-(3-trimethoxysilylpropylamino)phenyl]ethane-1,2-dione.
| Compound Name | 1-phenyl-2-[2-(3-trimethoxysilylpropylamino)phenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 67533346 |
| Molecular Formula | C20H25NO5Si |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-phenyl-2-[2-(3-trimethoxysilylpropylamino)phenyl]ethane-1,2-dione |
| SMILES | CO[Si](CCCNc1ccccc1C(=O)C(=O)c1ccccc1)(OC)OC |
| InChI | InChI=1S/C20H25NO5Si/c1-24-27(25-2,26-3)15-9-14-21-18-13-8-7-12-17(18)20(23)19(22)16-10-5-4-6-11-16/h4-8,10-13,21H,9,14-15H2,1-3H3 |
| InChIKey | TUZZBEDLMIOWFP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|