C21H32N2O3Si — CID 151955793
N-[4-[3-anilinopropyl(dimethoxy)silyl]oxybutyl]aniline (PubChem CID 151955793) has the molecular formula C21H32N2O3Si and a molecular weight of 388.58 g/mol. Its IUPAC name is N-[4-[3-anilinopropyl(dimethoxy)silyl]oxybutyl]aniline.
| Compound Name | N-[4-[3-anilinopropyl(dimethoxy)silyl]oxybutyl]aniline |
|---|---|
| PubChem CID | 151955793 |
| Molecular Formula | C21H32N2O3Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-[4-[3-anilinopropyl(dimethoxy)silyl]oxybutyl]aniline |
| SMILES | CO[Si](CCCNc1ccccc1)(OC)OCCCCNc1ccccc1 |
| InChI | InChI=1S/C21H32N2O3Si/c1-24-27(25-2,19-11-17-23-21-14-7-4-8-15-21)26-18-10-9-16-22-20-12-5-3-6-13-20/h3-8,12-15,22-23H,9-11,16-19H2,1-2H3 |
| InChIKey | TXPIYAUTQJVVNW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|