C15H23NO6Si — CID 174032259
2-[3-[ethoxy(dimethoxy)silyl]propylcarbamoyl]benzoic acid (PubChem CID 174032259) has the molecular formula C15H23NO6Si and a molecular weight of 341.44 g/mol. Its IUPAC name is 2-[3-[ethoxy(dimethoxy)silyl]propylcarbamoyl]benzoic acid.
| Compound Name | 2-[3-[ethoxy(dimethoxy)silyl]propylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 174032259 |
| Molecular Formula | C15H23NO6Si |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-[3-[ethoxy(dimethoxy)silyl]propylcarbamoyl]benzoic acid |
| SMILES | CCO[Si](CCCNC(=O)c1ccccc1C(=O)O)(OC)OC |
| InChI | InChI=1S/C15H23NO6Si/c1-4-22-23(20-2,21-3)11-7-10-16-14(17)12-8-5-6-9-13(12)15(18)19/h5-6,8-9H,4,7,10-11H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | WOXVCYISAWYWQK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|