C31H44N2O9Si2 — CID 174032254
5-[4-carboxy-3-[3-[ethoxy(dimethyl)silyl]propylcarbamoyl]benzoyl]-2-[3-[ethoxy(dimethyl)silyl]propylcarbamoyl]benzoic acid (PubChem CID 174032254) has the molecular formula C31H44N2O9Si2 and a molecular weight of 644.87 g/mol. Its IUPAC name is 5-[4-carboxy-3-[3-[ethoxy(dimethyl)silyl]propylcarbamoyl]benzoyl]-2-[3-[ethoxy(dimethyl)silyl]propylcarbamoyl]benzoic acid.
| Compound Name | 5-[4-carboxy-3-[3-[ethoxy(dimethyl)silyl]propylcarbamoyl]benzoyl]-2-[3-[ethoxy(dimethyl)silyl]propylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 174032254 |
| Molecular Formula | C31H44N2O9Si2 |
| Molecular Weight | 644.87 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | 5-[4-carboxy-3-[3-[ethoxy(dimethyl)silyl]propylcarbamoyl]benzoyl]-2-[3-[ethoxy(dimethyl)silyl]propylcarbamoyl]benzoic acid |
| SMILES | CCO[Si](C)(C)CCCNC(=O)c1ccc(C(=O)c2ccc(C(=O)O)c(C(=O)NCCC[Si](C)(C)OCC)c2)cc1C(=O)O |
| InChI | InChI=1S/C31H44N2O9Si2/c1-7-41-43(3,4)17-9-15-32-28(35)23-13-11-22(20-26(23)31(39)40)27(34)21-12-14-24(30(37)38)25(19-21)29(36)33-16-10-18-44(5,6)42-8-2/h11-14,19-20H,7-10,15-18H2,1-6H3,(H,32,35)(H,33,36)(H,37,38)(H,39,40) |
| InChIKey | BDONQCCNSQJTCQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.87 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|