C22H32N2O6 — CID 156689040
4,6-bis(hexylcarbamoyl)benzene-1,3-dicarboxylic acid (PubChem CID 156689040) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4,6-bis(hexylcarbamoyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4,6-bis(hexylcarbamoyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 156689040 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 4,6-bis(hexylcarbamoyl)benzene-1,3-dicarboxylic acid |
| SMILES | CCCCCCNC(=O)c1cc(C(=O)NCCCCCC)c(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C22H32N2O6/c1-3-5-7-9-11-23-19(25)15-13-16(20(26)24-12-10-8-6-4-2)18(22(29)30)14-17(15)21(27)28/h13-14H,3-12H2,1-2H3,(H,23,25)(H,24,26)(H,27,28)(H,29,30) |
| InChIKey | XVDVZOGYZCIJJZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|