C26H34N2O6 — CID 69296098
5,8-bis(hexylcarbamoyl)naphthalene-1,4-dicarboxylic acid (PubChem CID 69296098) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is 5,8-bis(hexylcarbamoyl)naphthalene-1,4-dicarboxylic acid.
| Compound Name | 5,8-bis(hexylcarbamoyl)naphthalene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 69296098 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 5,8-bis(hexylcarbamoyl)naphthalene-1,4-dicarboxylic acid |
| SMILES | CCCCCCNC(=O)c1ccc(C(=O)NCCCCCC)c2c(C(=O)O)ccc(C(=O)O)c12 |
| InChI | InChI=1S/C26H34N2O6/c1-3-5-7-9-15-27-23(29)17-11-12-18(24(30)28-16-10-8-6-4-2)22-20(26(33)34)14-13-19(21(17)22)25(31)32/h11-14H,3-10,15-16H2,1-2H3,(H,27,29)(H,28,30)(H,31,32)(H,33,34) |
| InChIKey | RHTASMVIGRWMCN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|