C30H26N2O6 — CID 87793298
9,10-bis(propylcarbamoyl)perylene-3,4-dicarboxylic acid (PubChem CID 87793298) has the molecular formula C30H26N2O6 and a molecular weight of 510.55 g/mol. Its IUPAC name is 9,10-bis(propylcarbamoyl)perylene-3,4-dicarboxylic acid.
| Compound Name | 9,10-bis(propylcarbamoyl)perylene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 87793298 |
| Molecular Formula | C30H26N2O6 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 9,10-bis(propylcarbamoyl)perylene-3,4-dicarboxylic acid |
| SMILES | CCCNC(=O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)O)ccc(c5ccc(C(=O)NCCC)c1c25)c43 |
| InChI | InChI=1S/C30H26N2O6/c1-3-13-31-27(33)19-9-5-15-17-7-11-21(29(35)36)26-22(30(37)38)12-8-18(24(17)26)16-6-10-20(25(19)23(15)16)28(34)32-14-4-2/h5-12H,3-4,13-14H2,1-2H3,(H,31,33)(H,32,34)(H,35,36)(H,37,38) |
| InChIKey | CAUUUMKTTMMDCT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|