C42H34N2O6 — CID 123701745
4-(4-phenylbutan-2-ylcarbamoyl)-10-(2-phenylethylcarbamoyl)perylene-3,9-dicarboxylic acid (PubChem CID 123701745) has the molecular formula C42H34N2O6 and a molecular weight of 662.74 g/mol. Its IUPAC name is 4-(4-phenylbutan-2-ylcarbamoyl)-10-(2-phenylethylcarbamoyl)perylene-3,9-dicarboxylic acid.
| Compound Name | 4-(4-phenylbutan-2-ylcarbamoyl)-10-(2-phenylethylcarbamoyl)perylene-3,9-dicarboxylic acid |
|---|---|
| PubChem CID | 123701745 |
| Molecular Formula | C42H34N2O6 |
| Molecular Weight | 662.74 g/mol |
| Exact Mass | 662.24 |
| IUPAC Name | 4-(4-phenylbutan-2-ylcarbamoyl)-10-(2-phenylethylcarbamoyl)perylene-3,9-dicarboxylic acid |
| SMILES | CC(CCc1ccccc1)NC(=O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)NCCc5ccccc5)ccc(c5ccc(C(=O)O)c1c52)c43 |
| InChI | InChI=1S/C42H34N2O6/c1-24(12-13-25-8-4-2-5-9-25)44-40(46)32-19-15-28-29-16-20-33(41(47)48)37-31(39(45)43-23-22-26-10-6-3-7-11-26)18-14-27(35(29)37)30-17-21-34(42(49)50)38(32)36(28)30/h2-11,14-21,24H,12-13,22-23H2,1H3,(H,43,45)(H,44,46)(H,47,48)(H,49,50) |
| InChIKey | NHEQNAQFWWZKFP-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.74 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|