C28H24N4O6 — CID 102479153
4,10-bis(2-aminoethylcarbamoyl)perylene-3,9-dicarboxylic acid (PubChem CID 102479153) has the molecular formula C28H24N4O6 and a molecular weight of 512.52 g/mol. Its IUPAC name is 4,10-bis(2-aminoethylcarbamoyl)perylene-3,9-dicarboxylic acid.
| Compound Name | 4,10-bis(2-aminoethylcarbamoyl)perylene-3,9-dicarboxylic acid |
|---|---|
| PubChem CID | 102479153 |
| Molecular Formula | C28H24N4O6 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 4,10-bis(2-aminoethylcarbamoyl)perylene-3,9-dicarboxylic acid |
| SMILES | NCCNC(=O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)NCCN)ccc(c5ccc(C(=O)O)c1c52)c43 |
| InChI | InChI=1S/C28H24N4O6/c29-9-11-31-25(33)17-5-1-13-15-3-7-20(28(37)38)24-18(26(34)32-12-10-30)6-2-14(22(15)24)16-4-8-19(27(35)36)23(17)21(13)16/h1-8H,9-12,29-30H2,(H,31,33)(H,32,34)(H,35,36)(H,37,38) |
| InChIKey | CIIODNQNTRFODZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|