C30H26N2O5 — CID 88871086
4-formyl-5,8-bis(2-phenylethylcarbamoyl)naphthalene-1-carboxylic acid (PubChem CID 88871086) has the molecular formula C30H26N2O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is 4-formyl-5,8-bis(2-phenylethylcarbamoyl)naphthalene-1-carboxylic acid.
| Compound Name | 4-formyl-5,8-bis(2-phenylethylcarbamoyl)naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 88871086 |
| Molecular Formula | C30H26N2O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 4-formyl-5,8-bis(2-phenylethylcarbamoyl)naphthalene-1-carboxylic acid |
| SMILES | O=Cc1ccc(C(=O)O)c2c(C(=O)NCCc3ccccc3)ccc(C(=O)NCCc3ccccc3)c12 |
| InChI | InChI=1S/C30H26N2O5/c33-19-22-11-12-25(30(36)37)27-24(29(35)32-18-16-21-9-5-2-6-10-21)14-13-23(26(22)27)28(34)31-17-15-20-7-3-1-4-8-20/h1-14,19H,15-18H2,(H,31,34)(H,32,35)(H,36,37) |
| InChIKey | OVXZFBAQLBWTOS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|