C32H32N2O6 — CID 123770692
4-[hydroxy-[2-(3-methylphenyl)ethylamino]methyl]-8-[2-(3-methylphenyl)ethylcarbamoyl]naphthalene-1,5-dicarboxylic acid (PubChem CID 123770692) has the molecular formula C32H32N2O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 4-[hydroxy-[2-(3-methylphenyl)ethylamino]methyl]-8-[2-(3-methylphenyl)ethylcarbamoyl]naphthalene-1,5-dicarboxylic acid.
| Compound Name | 4-[hydroxy-[2-(3-methylphenyl)ethylamino]methyl]-8-[2-(3-methylphenyl)ethylcarbamoyl]naphthalene-1,5-dicarboxylic acid |
|---|---|
| PubChem CID | 123770692 |
| Molecular Formula | C32H32N2O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 4-[hydroxy-[2-(3-methylphenyl)ethylamino]methyl]-8-[2-(3-methylphenyl)ethylcarbamoyl]naphthalene-1,5-dicarboxylic acid |
| SMILES | Cc1cccc(CCNC(=O)c2ccc(C(=O)O)c3c(C(O)NCCc4cccc(C)c4)ccc(C(=O)O)c23)c1 |
| InChI | InChI=1S/C32H32N2O6/c1-19-5-3-7-21(17-19)13-15-33-29(35)23-9-11-26(32(39)40)28-24(10-12-25(27(23)28)31(37)38)30(36)34-16-14-22-8-4-6-20(2)18-22/h3-12,17-18,29,33,35H,13-16H2,1-2H3,(H,34,36)(H,37,38)(H,39,40) |
| InChIKey | WBGOTWFHACHTHZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|