C17H18N2O3 — CID 60611649
2-methyl-N-[2-(3-methylphenyl)ethyl]-5-nitrobenzamide (PubChem CID 60611649) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-methyl-N-[2-(3-methylphenyl)ethyl]-5-nitrobenzamide.
| Compound Name | 2-methyl-N-[2-(3-methylphenyl)ethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 60611649 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-methyl-N-[2-(3-methylphenyl)ethyl]-5-nitrobenzamide |
| SMILES | Cc1cccc(CCNC(=O)c2cc([N+](=O)[O-])ccc2C)c1 |
| InChI | InChI=1S/C17H18N2O3/c1-12-4-3-5-14(10-12)8-9-18-17(20)16-11-15(19(21)22)7-6-13(16)2/h3-7,10-11H,8-9H2,1-2H3,(H,18,20) |
| InChIKey | RSMIXTSEIKFBJH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|