C19H23N3O6 — CID 174437081
2-(1,3-dihydroxypropan-2-ylamino)-N-[2-(3-methoxyphenyl)ethyl]-5-nitrobenzamide (PubChem CID 174437081) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-(1,3-dihydroxypropan-2-ylamino)-N-[2-(3-methoxyphenyl)ethyl]-5-nitrobenzamide.
| Compound Name | 2-(1,3-dihydroxypropan-2-ylamino)-N-[2-(3-methoxyphenyl)ethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 174437081 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-(1,3-dihydroxypropan-2-ylamino)-N-[2-(3-methoxyphenyl)ethyl]-5-nitrobenzamide |
| SMILES | COc1cccc(CCNC(=O)c2cc([N+](=O)[O-])ccc2NC(CO)CO)c1 |
| InChI | InChI=1S/C19H23N3O6/c1-28-16-4-2-3-13(9-16)7-8-20-19(25)17-10-15(22(26)27)5-6-18(17)21-14(11-23)12-24/h2-6,9-10,14,21,23-24H,7-8,11-12H2,1H3,(H,20,25) |
| InChIKey | QETAXZXTICWJMM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|