C20H17NO7 — CID 89333002
4-[3-carboxy-4-(propylcarbamoyl)benzoyl]-2-formylbenzoic acid (PubChem CID 89333002) has the molecular formula C20H17NO7 and a molecular weight of 383.36 g/mol. Its IUPAC name is 4-[3-carboxy-4-(propylcarbamoyl)benzoyl]-2-formylbenzoic acid.
| Compound Name | 4-[3-carboxy-4-(propylcarbamoyl)benzoyl]-2-formylbenzoic acid |
|---|---|
| PubChem CID | 89333002 |
| Molecular Formula | C20H17NO7 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 4-[3-carboxy-4-(propylcarbamoyl)benzoyl]-2-formylbenzoic acid |
| SMILES | CCCNC(=O)c1ccc(C(=O)c2ccc(C(=O)O)c(C=O)c2)cc1C(=O)O |
| InChI | InChI=1S/C20H17NO7/c1-2-7-21-18(24)15-6-4-12(9-16(15)20(27)28)17(23)11-3-5-14(19(25)26)13(8-11)10-22/h3-6,8-10H,2,7H2,1H3,(H,21,24)(H,25,26)(H,27,28) |
| InChIKey | HQJYUYCECRQHKC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|