C14H17NO5 — CID 69498373
(E)-but-2-enedioic acid;N-propylbenzamide (PubChem CID 69498373) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-propylbenzamide.
| Compound Name | (E)-but-2-enedioic acid;N-propylbenzamide |
|---|---|
| PubChem CID | 69498373 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (E)-but-2-enedioic acid;N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C10H13NO.C4H4O4/c1-2-8-11-10(12)9-6-4-3-5-7-9;5-3(6)1-2-4(7)8/h3-7H,2,8H2,1H3,(H,11,12);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | GBFAVBOHFYDGRF-WLHGVMLRSA-N |
| XLogP | 1.54 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|