C24H12O8 — CID 87368294
perylene-1,4,9,10-tetracarboxylic acid (PubChem CID 87368294) has the molecular formula C24H12O8 and a molecular weight of 428.35 g/mol. Its IUPAC name is perylene-1,4,9,10-tetracarboxylic acid.
| Compound Name | perylene-1,4,9,10-tetracarboxylic acid |
|---|---|
| PubChem CID | 87368294 |
| Molecular Formula | C24H12O8 |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | perylene-1,4,9,10-tetracarboxylic acid |
| SMILES | O=C(O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)O)ccc(c5c(C(=O)O)ccc1c25)c43 |
| InChI | InChI=1S/C24H12O8/c25-21(26)12-4-1-9-10-2-6-15(23(29)30)20-16(24(31)32)8-5-13(18(10)20)19-14(22(27)28)7-3-11(12)17(9)19/h1-8H,(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | RVNLIUXBNSMKDK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|