C32H30N2O6 — CID 87756017
9,10-bis(tert-butylcarbamoyl)perylene-3,4-dicarboxylic acid (PubChem CID 87756017) has the molecular formula C32H30N2O6 and a molecular weight of 538.60 g/mol. Its IUPAC name is 9,10-bis(tert-butylcarbamoyl)perylene-3,4-dicarboxylic acid.
| Compound Name | 9,10-bis(tert-butylcarbamoyl)perylene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 87756017 |
| Molecular Formula | C32H30N2O6 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 9,10-bis(tert-butylcarbamoyl)perylene-3,4-dicarboxylic acid |
| SMILES | CC(C)(C)NC(=O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)O)ccc(c5ccc(C(=O)NC(C)(C)C)c1c25)c43 |
| InChI | InChI=1S/C32H30N2O6/c1-31(2,3)33-27(35)19-11-7-15-17-9-13-21(29(37)38)26-22(30(39)40)14-10-18(24(17)26)16-8-12-20(25(19)23(15)16)28(36)34-32(4,5)6/h7-14H,1-6H3,(H,33,35)(H,34,36)(H,37,38)(H,39,40) |
| InChIKey | YEWFSZLZOUDQIO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|