C26H42N4O4 — CID 141420303
1-N,2-N,4-N,5-N-tetratert-butylbenzene-1,2,4,5-tetracarboxamide (PubChem CID 141420303) has the molecular formula C26H42N4O4 and a molecular weight of 474.65 g/mol. Its IUPAC name is 1-N,2-N,4-N,5-N-tetratert-butylbenzene-1,2,4,5-tetracarboxamide.
| Compound Name | 1-N,2-N,4-N,5-N-tetratert-butylbenzene-1,2,4,5-tetracarboxamide |
|---|---|
| PubChem CID | 141420303 |
| Molecular Formula | C26H42N4O4 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | 1-N,2-N,4-N,5-N-tetratert-butylbenzene-1,2,4,5-tetracarboxamide |
| SMILES | CC(C)(C)NC(=O)c1cc(C(=O)NC(C)(C)C)c(C(=O)NC(C)(C)C)cc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C26H42N4O4/c1-23(2,3)27-19(31)15-13-17(21(33)29-25(7,8)9)18(22(34)30-26(10,11)12)14-16(15)20(32)28-24(4,5)6/h13-14H,1-12H3,(H,27,31)(H,28,32)(H,29,33)(H,30,34) |
| InChIKey | CTLYSPJWMFCQBE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |