C20H32N2O3 — CID 11397419
1-N,3-N,5-tritert-butyl-2-hydroxybenzene-1,3-dicarboxamide (PubChem CID 11397419) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-N,3-N,5-tritert-butyl-2-hydroxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N,5-tritert-butyl-2-hydroxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 11397419 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 1-N,3-N,5-tritert-butyl-2-hydroxybenzene-1,3-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)c1cc(C(C)(C)C)cc(C(=O)NC(C)(C)C)c1O |
| InChI | InChI=1S/C20H32N2O3/c1-18(2,3)12-10-13(16(24)21-19(4,5)6)15(23)14(11-12)17(25)22-20(7,8)9/h10-11,23H,1-9H3,(H,21,24)(H,22,25) |
| InChIKey | OQXWNSDDVNASCM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |