C15H24N2O — CID 121391265
N,6-ditert-butyl-4-methylpyridine-3-carboxamide (PubChem CID 121391265) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is N,6-ditert-butyl-4-methylpyridine-3-carboxamide.
| Compound Name | N,6-ditert-butyl-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 121391265 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N,6-ditert-butyl-4-methylpyridine-3-carboxamide |
| SMILES | Cc1cc(C(C)(C)C)ncc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H24N2O/c1-10-8-12(14(2,3)4)16-9-11(10)13(18)17-15(5,6)7/h8-9H,1-7H3,(H,17,18) |
| InChIKey | IPBLCHRWEBJSMH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |