C16H25N3O2 — CID 101053138
2-N,5-N-ditert-butyl-3-methylpyridine-2,5-dicarboxamide (PubChem CID 101053138) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-N,5-N-ditert-butyl-3-methylpyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-ditert-butyl-3-methylpyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 101053138 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-N,5-N-ditert-butyl-3-methylpyridine-2,5-dicarboxamide |
| SMILES | Cc1cc(C(=O)NC(C)(C)C)cnc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H25N3O2/c1-10-8-11(13(20)18-15(2,3)4)9-17-12(10)14(21)19-16(5,6)7/h8-9H,1-7H3,(H,18,20)(H,19,21) |
| InChIKey | MFZOZGONHQUQSW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |