C16H20N2O — CID 47130649
N-tert-butyl-2,6-dimethylquinoline-3-carboxamide (PubChem CID 47130649) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is N-tert-butyl-2,6-dimethylquinoline-3-carboxamide.
| Compound Name | N-tert-butyl-2,6-dimethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 47130649 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-tert-butyl-2,6-dimethylquinoline-3-carboxamide |
| SMILES | Cc1ccc2nc(C)c(C(=O)NC(C)(C)C)cc2c1 |
| InChI | InChI=1S/C16H20N2O/c1-10-6-7-14-12(8-10)9-13(11(2)17-14)15(19)18-16(3,4)5/h6-9H,1-5H3,(H,18,19) |
| InChIKey | IBXLSXFPGRWRPA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |