C18H14BrFN2O — CID 100642237
N-(2-bromo-6-fluorophenyl)-2,6-dimethylquinoline-3-carboxamide (PubChem CID 100642237) has the molecular formula C18H14BrFN2O and a molecular weight of 373.23 g/mol. Its IUPAC name is N-(2-bromo-6-fluorophenyl)-2,6-dimethylquinoline-3-carboxamide.
| Compound Name | N-(2-bromo-6-fluorophenyl)-2,6-dimethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 100642237 |
| Molecular Formula | C18H14BrFN2O |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | N-(2-bromo-6-fluorophenyl)-2,6-dimethylquinoline-3-carboxamide |
| SMILES | Cc1ccc2nc(C)c(C(=O)Nc3c(F)cccc3Br)cc2c1 |
| InChI | InChI=1S/C18H14BrFN2O/c1-10-6-7-16-12(8-10)9-13(11(2)21-16)18(23)22-17-14(19)4-3-5-15(17)20/h3-9H,1-2H3,(H,22,23) |
| InChIKey | DCIZDXOWGNUYMZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |