C20H18N2O3 — CID 34059816
methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate (PubChem CID 34059816) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate.
| Compound Name | methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 34059816 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cc3cc(C)ccc3nc2C)c1 |
| InChI | InChI=1S/C20H18N2O3/c1-12-7-8-18-15(9-12)11-17(13(2)21-18)19(23)22-16-6-4-5-14(10-16)20(24)25-3/h4-11H,1-3H3,(H,22,23) |
| InChIKey | GKQXWUCJLYSPEO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |