methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate

C20H18N2O3 — CID 34059816

IUPACmethyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)c2cc3cc(C)ccc3nc2C)c1
InChIInChI=1S/C20H18N2O3/c1-12-7-8-18-15(9-12)11-17(13(2)21-18)19(23)22-16-6-4-5-14(10-16)20(24)25-3/h4-11H,1-3H3,(H,22,23)
InChIKeyGKQXWUCJLYSPEO-UHFFFAOYSA-N
MW334.38 g/mol
LogP3.89
Rot. Bonds3

About methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate

methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate (PubChem CID 34059816) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate.

Molecular Properties

Compound Namemethyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate
PubChem CID34059816
Molecular FormulaC20H18N2O3
Molecular Weight334.38 g/mol
Exact Mass334.13
IUPAC Namemethyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)c2cc3cc(C)ccc3nc2C)c1
InChIInChI=1S/C20H18N2O3/c1-12-7-8-18-15(9-12)11-17(13(2)21-18)19(23)22-16-6-4-5-14(10-16)20(24)25-3/h4-11H,1-3H3,(H,22,23)
InChIKeyGKQXWUCJLYSPEO-UHFFFAOYSA-N
XLogP3.89
TPSA68.29 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.38
LogP ≤ 53.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate?
The IUPAC name of methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate (CID 34059816) is methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate.
What is the SMILES notation for methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate?
The canonical SMILES for methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate is COC(=O)c1cccc(NC(=O)c2cc3cc(C)ccc3nc2C)c1.
What is the InChIKey of methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate?
The InChIKey is GKQXWUCJLYSPEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O3/c1-12-7-8-18-15(9-12)11-17(13(2)21-18)19(23)22-16-6-4-5-14(10-16)20(24)25-3/h4-11H,1-3H3,(H,22,23).
What are the key properties of methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate?
methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate has a molecular weight of 334.38 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2,6-dimethylquinoline-3-carbonyl)amino]benzoate is sourced from PubChem (CID 34059816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).