C21H21N3O3 — CID 33311358
N-(3-acetamido-4-methoxyphenyl)-2,6-dimethylquinoline-3-carboxamide (PubChem CID 33311358) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-(3-acetamido-4-methoxyphenyl)-2,6-dimethylquinoline-3-carboxamide.
| Compound Name | N-(3-acetamido-4-methoxyphenyl)-2,6-dimethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 33311358 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-(3-acetamido-4-methoxyphenyl)-2,6-dimethylquinoline-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3cc(C)ccc3nc2C)cc1NC(C)=O |
| InChI | InChI=1S/C21H21N3O3/c1-12-5-7-18-15(9-12)10-17(13(2)22-18)21(26)24-16-6-8-20(27-4)19(11-16)23-14(3)25/h5-11H,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | LLUMLIONWSJAIZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |