methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate

C15H15NO3S — CID 17417091

IUPACmethyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)c2cc(C)sc2C)c1
InChIInChI=1S/C15H15NO3S/c1-9-7-13(10(2)20-9)14(17)16-12-6-4-5-11(8-12)15(18)19-3/h4-8H,1-3H3,(H,16,17)
InChIKeyYPQLITXOPITCSD-UHFFFAOYSA-N
MW289.36 g/mol
LogP3.40
Rot. Bonds3

About methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate

methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate (PubChem CID 17417091) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate.

Molecular Properties

Compound Namemethyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate
PubChem CID17417091
Molecular FormulaC15H15NO3S
Molecular Weight289.36 g/mol
Exact Mass289.08
IUPAC Namemethyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)c2cc(C)sc2C)c1
InChIInChI=1S/C15H15NO3S/c1-9-7-13(10(2)20-9)14(17)16-12-6-4-5-11(8-12)15(18)19-3/h4-8H,1-3H3,(H,16,17)
InChIKeyYPQLITXOPITCSD-UHFFFAOYSA-N
XLogP3.40
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.36
LogP ≤ 53.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate?
The IUPAC name of methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate (CID 17417091) is methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate.
What is the SMILES notation for methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate?
The canonical SMILES for methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate is COC(=O)c1cccc(NC(=O)c2cc(C)sc2C)c1.
What is the InChIKey of methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate?
The InChIKey is YPQLITXOPITCSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3S/c1-9-7-13(10(2)20-9)14(17)16-12-6-4-5-11(8-12)15(18)19-3/h4-8H,1-3H3,(H,16,17).
What are the key properties of methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate?
methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate has a molecular weight of 289.36 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2,5-dimethylthiophene-3-carbonyl)amino]benzoate is sourced from PubChem (CID 17417091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).