C13H12FNOS — CID 18196520
N-(3-fluorophenyl)-2,5-dimethylthiophene-3-carboxamide (PubChem CID 18196520) has the molecular formula C13H12FNOS and a molecular weight of 249.31 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2,5-dimethylthiophene-3-carboxamide.
| Compound Name | N-(3-fluorophenyl)-2,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 18196520 |
| Molecular Formula | C13H12FNOS |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | N-(3-fluorophenyl)-2,5-dimethylthiophene-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(F)c2)c(C)s1 |
| InChI | InChI=1S/C13H12FNOS/c1-8-6-12(9(2)17-8)13(16)15-11-5-3-4-10(14)7-11/h3-7H,1-2H3,(H,15,16) |
| InChIKey | KQZZTGJYQNYVOI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |