C21H20N2OS2 — CID 35852244
N-[3-(1,3-dithiolan-2-yl)phenyl]-2,6-dimethylquinoline-3-carboxamide (PubChem CID 35852244) has the molecular formula C21H20N2OS2 and a molecular weight of 380.54 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]-2,6-dimethylquinoline-3-carboxamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-2,6-dimethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 35852244 |
| Molecular Formula | C21H20N2OS2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-2,6-dimethylquinoline-3-carboxamide |
| SMILES | Cc1ccc2nc(C)c(C(=O)Nc3cccc(C4SCCS4)c3)cc2c1 |
| InChI | InChI=1S/C21H20N2OS2/c1-13-6-7-19-16(10-13)12-18(14(2)22-19)20(24)23-17-5-3-4-15(11-17)21-25-8-9-26-21/h3-7,10-12,21H,8-9H2,1-2H3,(H,23,24) |
| InChIKey | ZXYMLWMOFGIJRB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |