C17H17NO2S2 — CID 51580161
N-[3-(1,3-dithiolan-2-yl)phenyl]-2-hydroxy-5-methylbenzamide (PubChem CID 51580161) has the molecular formula C17H17NO2S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]-2-hydroxy-5-methylbenzamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-2-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 51580161 |
| Molecular Formula | C17H17NO2S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-2-hydroxy-5-methylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)Nc2cccc(C3SCCS3)c2)c1 |
| InChI | InChI=1S/C17H17NO2S2/c1-11-5-6-15(19)14(9-11)16(20)18-13-4-2-3-12(10-13)17-21-7-8-22-17/h2-6,9-10,17,19H,7-8H2,1H3,(H,18,20) |
| InChIKey | CADZICVSCVLUQS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |