C12H15NOS3 — CID 35368286
N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylsulfanylacetamide (PubChem CID 35368286) has the molecular formula C12H15NOS3 and a molecular weight of 285.46 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylsulfanylacetamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 35368286 |
| Molecular Formula | C12H15NOS3 |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)Nc1cccc(C2SCCS2)c1 |
| InChI | InChI=1S/C12H15NOS3/c1-15-8-11(14)13-10-4-2-3-9(7-10)12-16-5-6-17-12/h2-4,7,12H,5-6,8H2,1H3,(H,13,14) |
| InChIKey | BOJIXSWEXGSFHB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |